About 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol
4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol (PubChem CID 107679293) has the molecular formula C14H17Cl2N3O
and a molecular weight of 314.22 g/mol. Its IUPAC name is 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol.
Molecular Properties
| Compound Name | 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol |
| PubChem CID | 107679293 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol |
| SMILES | CC(C)(C)n1cc(CNc2cc(Cl)c(O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-14(2,3)19-8-9(7-18-19)6-17-10-4-11(15)13(20)12(16)5-10/h4-5,7-8,17,20H,6H2,1-3H3 |
| InChIKey | UVXIPCUINPACMP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol?
The IUPAC name of 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol (CID 107679293) is 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol.
What is the SMILES notation for 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol?
The canonical SMILES for 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol is CC(C)(C)n1cc(CNc2cc(Cl)c(O)c(Cl)c2)cn1.
What is the InChIKey of 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol?
The InChIKey is UVXIPCUINPACMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3O/c1-14(2,3)19-8-9(7-18-19)6-17-10-4-11(15)13(20)12(16)5-10/h4-5,7-8,17,20H,6H2,1-3H3.
What are the key properties of 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol?
4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol has a molecular weight of 314.22 g/mol, XLogP of 4.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol is sourced from PubChem (CID 107679293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).