C14H17Cl2N3O — CID 107679293
4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol (PubChem CID 107679293) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol.
| Compound Name | 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol |
|---|---|
| PubChem CID | 107679293 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-[(1-tert-butylpyrazol-4-yl)methylamino]-2,6-dichlorophenol |
| SMILES | CC(C)(C)n1cc(CNc2cc(Cl)c(O)c(Cl)c2)cn1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-14(2,3)19-8-9(7-18-19)6-17-10-4-11(15)13(20)12(16)5-10/h4-5,7-8,17,20H,6H2,1-3H3 |
| InChIKey | UVXIPCUINPACMP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|