C14H13Cl2NO3 — CID 107679453
2-[1-(3,5-dichloro-4-hydroxyanilino)ethyl]benzene-1,4-diol (PubChem CID 107679453) has the molecular formula C14H13Cl2NO3 and a molecular weight of 314.17 g/mol. Its IUPAC name is 2-[1-(3,5-dichloro-4-hydroxyanilino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(3,5-dichloro-4-hydroxyanilino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 107679453 |
| Molecular Formula | C14H13Cl2NO3 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 2-[1-(3,5-dichloro-4-hydroxyanilino)ethyl]benzene-1,4-diol |
| SMILES | CC(Nc1cc(Cl)c(O)c(Cl)c1)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H13Cl2NO3/c1-7(10-6-9(18)2-3-13(10)19)17-8-4-11(15)14(20)12(16)5-8/h2-7,17-20H,1H3 |
| InChIKey | CXSCRAGDXQACOV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|