C20H22F3NO9S — CID 10767967
[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfinyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate (PubChem CID 10767967) has the molecular formula C20H22F3NO9S and a molecular weight of 509.46 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfinyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfinyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10767967 |
| Molecular Formula | C20H22F3NO9S |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-3,4-diacetyloxy-6-(benzenesulfinyl)-5-[(2,2,2-trifluoroacetyl)amino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S(=O)c2ccccc2)[C@H](NC(=O)C(F)(F)F)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H22F3NO9S/c1-10(25)30-9-14-16(31-11(2)26)17(32-12(3)27)15(24-19(28)20(21,22)23)18(33-14)34(29)13-7-5-4-6-8-13/h4-8,14-18H,9H2,1-3H3,(H,24,28)/t14-,15-,16-,17-,18+,34?/m1/s1 |
| InChIKey | NIXSFPHTOXTPOW-QBMGXIFZSA-N |
| XLogP | 0.99 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|