C14H19ClN2O2 — CID 107679893
N-(3-chloro-4-hydroxyphenyl)-3-piperidin-2-ylpropanamide (PubChem CID 107679893) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is N-(3-chloro-4-hydroxyphenyl)-3-piperidin-2-ylpropanamide.
| Compound Name | N-(3-chloro-4-hydroxyphenyl)-3-piperidin-2-ylpropanamide |
|---|---|
| PubChem CID | 107679893 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-(3-chloro-4-hydroxyphenyl)-3-piperidin-2-ylpropanamide |
| SMILES | O=C(CCC1CCCCN1)Nc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O2/c15-12-9-11(4-6-13(12)18)17-14(19)7-5-10-3-1-2-8-16-10/h4,6,9-10,16,18H,1-3,5,7-8H2,(H,17,19) |
| InChIKey | WPUZHEZAYMPGTN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|