C16H17NO4 — CID 107680223
2-(3-hydroxy-5-methylphenoxy)-N-(2-methoxyphenyl)acetamide (PubChem CID 107680223) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-(3-hydroxy-5-methylphenoxy)-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(3-hydroxy-5-methylphenoxy)-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 107680223 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(3-hydroxy-5-methylphenoxy)-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)COc1cc(C)cc(O)c1 |
| InChI | InChI=1S/C16H17NO4/c1-11-7-12(18)9-13(8-11)21-10-16(19)17-14-5-3-4-6-15(14)20-2/h3-9,18H,10H2,1-2H3,(H,17,19) |
| InChIKey | PNQDZEDJRXHGJE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |