C11H12Cl2N2O2 — CID 107680422
N-(3,5-dichloro-4-hydroxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 107680422) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is N-(3,5-dichloro-4-hydroxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(3,5-dichloro-4-hydroxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107680422 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | N-(3,5-dichloro-4-hydroxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(O)c(Cl)c1)C1CCCN1 |
| InChI | InChI=1S/C11H12Cl2N2O2/c12-7-4-6(5-8(13)10(7)16)15-11(17)9-2-1-3-14-9/h4-5,9,14,16H,1-3H2,(H,15,17) |
| InChIKey | AARUWKVCLXHYHL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|