C15H12N2O4 — CID 107681222
N-(2-hydroxy-6-nitrophenyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 107681222) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is N-(2-hydroxy-6-nitrophenyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-(2-hydroxy-6-nitrophenyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 107681222 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N-(2-hydroxy-6-nitrophenyl)bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | O=C(Nc1c(O)cccc1[N+](=O)[O-])C1Cc2ccccc21 |
| InChI | InChI=1S/C15H12N2O4/c18-13-7-3-6-12(17(20)21)14(13)16-15(19)11-8-9-4-1-2-5-10(9)11/h1-7,11,18H,8H2,(H,16,19) |
| InChIKey | RKOAACRNBRQHMB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|