About 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one
1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one (PubChem CID 107682187) has the molecular formula C16H18N2O2
and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one.
Molecular Properties
| Compound Name | 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one |
| PubChem CID | 107682187 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one |
| SMILES | CCn1cc(NC2CCc3cc(O)ccc32)ccc1=O |
| InChI | InChI=1S/C16H18N2O2/c1-2-18-10-12(4-8-16(18)20)17-15-7-3-11-9-13(19)5-6-14(11)15/h4-6,8-10,15,17,19H,2-3,7H2,1H3 |
| InChIKey | UMWXVAAXGDAAIU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one?
The IUPAC name of 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one (CID 107682187) is 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one.
What is the SMILES notation for 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one?
The canonical SMILES for 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one is CCn1cc(NC2CCc3cc(O)ccc32)ccc1=O.
What is the InChIKey of 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one?
The InChIKey is UMWXVAAXGDAAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2/c1-2-18-10-12(4-8-16(18)20)17-15-7-3-11-9-13(19)5-6-14(11)15/h4-6,8-10,15,17,19H,2-3,7H2,1H3.
What are the key properties of 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one?
1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one has a molecular weight of 270.33 g/mol, XLogP of 2.67, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-[(5-hydroxy-2,3-dihydro-1H-inden-1-yl)amino]pyridin-2-one is sourced from PubChem (CID 107682187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).