ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate

C14H19NO3 — CID 107683229

IUPACethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate
SMILESCCOC(=O)COc1ccc2c(c1)CCC2NC
InChIInChI=1S/C14H19NO3/c1-3-17-14(16)9-18-11-5-6-12-10(8-11)4-7-13(12)15-2/h5-6,8,13,15H,3-4,7,9H2,1-2H3
InChIKeyILJPIXBYJBWWCC-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.84
Rot. Bonds5

About ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate

ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate (PubChem CID 107683229) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate.

Molecular Properties

Compound Nameethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate
PubChem CID107683229
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Nameethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate
SMILESCCOC(=O)COc1ccc2c(c1)CCC2NC
InChIInChI=1S/C14H19NO3/c1-3-17-14(16)9-18-11-5-6-12-10(8-11)4-7-13(12)15-2/h5-6,8,13,15H,3-4,7,9H2,1-2H3
InChIKeyILJPIXBYJBWWCC-UHFFFAOYSA-N
XLogP1.84
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate?
The IUPAC name of ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate (CID 107683229) is ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate.
What is the SMILES notation for ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate?
The canonical SMILES for ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate is CCOC(=O)COc1ccc2c(c1)CCC2NC.
What is the InChIKey of ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate?
The InChIKey is ILJPIXBYJBWWCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-3-17-14(16)9-18-11-5-6-12-10(8-11)4-7-13(12)15-2/h5-6,8,13,15H,3-4,7,9H2,1-2H3.
What are the key properties of ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate?
ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate has a molecular weight of 249.31 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[1-(methylamino)-2,3-dihydro-1H-inden-5-yl]oxy]acetate is sourced from PubChem (CID 107683229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).