C27H27ClN4O3S — CID 10768364
N-[13-chloro-2-[1-(2-pyridin-4-ylacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-yl]methanesulfonamide (PubChem CID 10768364) has the molecular formula C27H27ClN4O3S and a molecular weight of 523.06 g/mol. Its IUPAC name is N-[13-chloro-2-[1-(2-pyridin-4-ylacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-yl]methanesulfonamide.
| Compound Name | N-[13-chloro-2-[1-(2-pyridin-4-ylacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10768364 |
| Molecular Formula | C27H27ClN4O3S |
| Molecular Weight | 523.06 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | N-[13-chloro-2-[1-(2-pyridin-4-ylacetyl)piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cnc2c(c1)CCc1cc(Cl)ccc1C2=C1CCN(C(=O)Cc2ccncc2)CC1 |
| InChI | InChI=1S/C27H27ClN4O3S/c1-36(34,35)31-23-16-21-3-2-20-15-22(28)4-5-24(20)26(27(21)30-17-23)19-8-12-32(13-9-19)25(33)14-18-6-10-29-11-7-18/h4-7,10-11,15-17,31H,2-3,8-9,12-14H2,1H3 |
| InChIKey | UMEAOCQWTBLFJV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.06 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |