About 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one
5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one (PubChem CID 107684093) has the molecular formula C13H14O5S
and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one |
| PubChem CID | 107684093 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OC3CS(=O)(=O)CC3O)ccc21 |
| InChI | InChI=1S/C13H14O5S/c14-11-4-1-8-5-9(2-3-10(8)11)18-13-7-19(16,17)6-12(13)15/h2-3,5,12-13,15H,1,4,6-7H2 |
| InChIKey | SXDLFLZNAMVKRH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one?
The IUPAC name of 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one (CID 107684093) is 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one?
The canonical SMILES for 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one is O=C1CCc2cc(OC3CS(=O)(=O)CC3O)ccc21.
What is the InChIKey of 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one?
The InChIKey is SXDLFLZNAMVKRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5S/c14-11-4-1-8-5-9(2-3-10(8)11)18-13-7-19(16,17)6-12(13)15/h2-3,5,12-13,15H,1,4,6-7H2.
What are the key properties of 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one?
5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one has a molecular weight of 282.32 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 107684093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).