C13H14O5S — CID 107684093
5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one (PubChem CID 107684093) has the molecular formula C13H14O5S and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one.
| Compound Name | 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 107684093 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 5-(4-hydroxy-1,1-dioxothiolan-3-yl)oxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OC3CS(=O)(=O)CC3O)ccc21 |
| InChI | InChI=1S/C13H14O5S/c14-11-4-1-8-5-9(2-3-10(8)11)18-13-7-19(16,17)6-12(13)15/h2-3,5,12-13,15H,1,4,6-7H2 |
| InChIKey | SXDLFLZNAMVKRH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |