C24H38N2O4SeSi — CID 10768420
1-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-(3,5-dimethylphenyl)selanyl-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 10768420) has the molecular formula C24H38N2O4SeSi and a molecular weight of 525.62 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-(3,5-dimethylphenyl)selanyl-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-(3,5-dimethylphenyl)selanyl-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10768420 |
| Molecular Formula | C24H38N2O4SeSi |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethoxymethyl]-6-(3,5-dimethylphenyl)selanyl-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc([Se]c2c(C(C)C)c(=O)[nH]c(=O)n2COCCO[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C24H38N2O4SeSi/c1-16(2)20-21(27)25-23(28)26(15-29-10-11-30-32(8,9)24(5,6)7)22(20)31-19-13-17(3)12-18(4)14-19/h12-14,16H,10-11,15H2,1-9H3,(H,25,27,28) |
| InChIKey | QWWKSFUXETVZOG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|