C16H23NO2 — CID 107685082
1-[methyl(oxan-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-ol (PubChem CID 107685082) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-[methyl(oxan-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 1-[methyl(oxan-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 107685082 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[methyl(oxan-4-ylmethyl)amino]-2,3-dihydro-1H-inden-5-ol |
| SMILES | CN(CC1CCOCC1)C1CCc2cc(O)ccc21 |
| InChI | InChI=1S/C16H23NO2/c1-17(11-12-6-8-19-9-7-12)16-5-2-13-10-14(18)3-4-15(13)16/h3-4,10,12,16,18H,2,5-9,11H2,1H3 |
| InChIKey | FHOOLHIMWHEFMI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |