C30H34FN5O3 — CID 10768579
1-[3-(dimethylamino)phenyl]-3-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]urea (PubChem CID 10768579) has the molecular formula C30H34FN5O3 and a molecular weight of 531.63 g/mol. Its IUPAC name is 1-[3-(dimethylamino)phenyl]-3-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]urea.
| Compound Name | 1-[3-(dimethylamino)phenyl]-3-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]urea |
|---|---|
| PubChem CID | 10768579 |
| Molecular Formula | C30H34FN5O3 |
| Molecular Weight | 531.63 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | 1-[3-(dimethylamino)phenyl]-3-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]urea |
| SMILES | CN(C)c1cccc(NC(=O)NC2C(=O)N(CCC(C)(C)C)c3ccccc3N(c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C30H34FN5O3/c1-30(2,3)17-18-35-24-15-8-9-16-25(24)36(23-14-7-6-13-22(23)31)28(38)26(27(35)37)33-29(39)32-20-11-10-12-21(19-20)34(4)5/h6-16,19,26H,17-18H2,1-5H3,(H2,32,33,39) |
| InChIKey | DXBZKZASSVRYNZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|