C19H22ClN5O7S2 — CID 10768593
2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate (PubChem CID 10768593) has the molecular formula C19H22ClN5O7S2 and a molecular weight of 532.00 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate.
| Compound Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 10768593 |
| Molecular Formula | C19H22ClN5O7S2 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | 2-(2,6-diethyl-4-phenylpyridin-1-ium-1-yl)-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide perchlorate |
| SMILES | CCc1cc(-c2ccccc2)cc(CC)[n+]1CC(=O)Nc1nnc(S(N)(=O)=O)s1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H21N5O3S2.ClHO4/c1-3-15-10-14(13-8-6-5-7-9-13)11-16(4-2)24(15)12-17(25)21-18-22-23-19(28-18)29(20,26)27;2-1(3,4)5/h5-11H,3-4,12H2,1-2H3,(H2-,20,21,22,25,26,27);(H,2,3,4,5) |
| InChIKey | LNBLERWITIILNO-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 211.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|