C27H43NO8Si — CID 10768731
[(3aS,4R,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate (PubChem CID 10768731) has the molecular formula C27H43NO8Si and a molecular weight of 537.73 g/mol. Its IUPAC name is [(3aS,4R,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate.
| Compound Name | [(3aS,4R,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
|---|---|
| PubChem CID | 10768731 |
| Molecular Formula | C27H43NO8Si |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | [(3aS,4R,6R,6aS)-6-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl] benzoate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1O[C@H](OC(=O)c2ccccc2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C27H43NO8Si/c1-25(2,3)36-24(30)28-18(16-31-37(9,10)26(4,5)6)19-20-21(35-27(7,8)34-20)23(32-19)33-22(29)17-14-12-11-13-15-17/h11-15,18-21,23H,16H2,1-10H3,(H,28,30)/t18-,19-,20+,21+,23-/m1/s1 |
| InChIKey | AMJGGYOMRLLBPX-UNRHHUQTSA-N |
| XLogP | 5.00 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|