C13H12N2O3 — CID 107687533
N-(4-aminophenyl)-2,6-dihydroxybenzamide (PubChem CID 107687533) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is N-(4-aminophenyl)-2,6-dihydroxybenzamide.
| Compound Name | N-(4-aminophenyl)-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107687533 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-(4-aminophenyl)-2,6-dihydroxybenzamide |
| SMILES | Nc1ccc(NC(=O)c2c(O)cccc2O)cc1 |
| InChI | InChI=1S/C13H12N2O3/c14-8-4-6-9(7-5-8)15-13(18)12-10(16)2-1-3-11(12)17/h1-7,16-17H,14H2,(H,15,18) |
| InChIKey | PBPCTXHCDGSHQL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|