C15H13NO5 — CID 107687790
4-[(2,6-dihydroxybenzoyl)amino]-3-methylbenzoic acid (PubChem CID 107687790) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-[(2,6-dihydroxybenzoyl)amino]-3-methylbenzoic acid.
| Compound Name | 4-[(2,6-dihydroxybenzoyl)amino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 107687790 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 4-[(2,6-dihydroxybenzoyl)amino]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1NC(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C15H13NO5/c1-8-7-9(15(20)21)5-6-10(8)16-14(19)13-11(17)3-2-4-12(13)18/h2-7,17-18H,1H3,(H,16,19)(H,20,21) |
| InChIKey | BUVWTXCCMNMHDF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |