C16H26FNO2 — CID 107688569
4-[4-[(tert-butylamino)methyl]-2-fluorophenoxy]-2-methylbutan-2-ol (PubChem CID 107688569) has the molecular formula C16H26FNO2 and a molecular weight of 283.39 g/mol. Its IUPAC name is 4-[4-[(tert-butylamino)methyl]-2-fluorophenoxy]-2-methylbutan-2-ol.
| Compound Name | 4-[4-[(tert-butylamino)methyl]-2-fluorophenoxy]-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 107688569 |
| Molecular Formula | C16H26FNO2 |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-[4-[(tert-butylamino)methyl]-2-fluorophenoxy]-2-methylbutan-2-ol |
| SMILES | CC(C)(O)CCOc1ccc(CNC(C)(C)C)cc1F |
| InChI | InChI=1S/C16H26FNO2/c1-15(2,3)18-11-12-6-7-14(13(17)10-12)20-9-8-16(4,5)19/h6-7,10,18-19H,8-9,11H2,1-5H3 |
| InChIKey | JCOFCYSADCHRDO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |