C27H27ClN2O6S — CID 10768870
4-[(2,4-diphenyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate (PubChem CID 10768870) has the molecular formula C27H27ClN2O6S and a molecular weight of 543.04 g/mol. Its IUPAC name is 4-[(2,4-diphenyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate.
| Compound Name | 4-[(2,4-diphenyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10768870 |
| Molecular Formula | C27H27ClN2O6S |
| Molecular Weight | 543.04 g/mol |
| Exact Mass | 542.13 |
| IUPAC Name | 4-[(2,4-diphenyl-6-propan-2-ylpyridin-1-ium-1-yl)methyl]benzenesulfonamide perchlorate |
| SMILES | CC(C)c1cc(-c2ccccc2)cc(-c2ccccc2)[n+]1Cc1ccc(S(N)(=O)=O)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C27H27N2O2S.ClHO4/c1-20(2)26-17-24(22-9-5-3-6-10-22)18-27(23-11-7-4-8-12-23)29(26)19-21-13-15-25(16-14-21)32(28,30)31;2-1(3,4)5/h3-18,20H,19H2,1-2H3,(H2,28,30,31);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | CTCGEPMTRZYMQT-UHFFFAOYSA-M |
| XLogP | 0.37 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.04 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|