C16H21NO4 — CID 107688771
1-[1-(2,6-dihydroxybenzoyl)azepan-2-yl]propan-2-one (PubChem CID 107688771) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[1-(2,6-dihydroxybenzoyl)azepan-2-yl]propan-2-one.
| Compound Name | 1-[1-(2,6-dihydroxybenzoyl)azepan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 107688771 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 1-[1-(2,6-dihydroxybenzoyl)azepan-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCCN1C(=O)c1c(O)cccc1O |
| InChI | InChI=1S/C16H21NO4/c1-11(18)10-12-6-3-2-4-9-17(12)16(21)15-13(19)7-5-8-14(15)20/h5,7-8,12,19-20H,2-4,6,9-10H2,1H3 |
| InChIKey | OWSKTKFVOJNIPQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |