C24H32O10S2 — CID 10768901
[(2S,3S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10768901) has the molecular formula C24H32O10S2 and a molecular weight of 544.64 g/mol. Its IUPAC name is [(2S,3S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10768901 |
| Molecular Formula | C24H32O10S2 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | [(2S,3S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-3-[(4-methylphenyl)sulfonyloxymethyl]-1,4-dioxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@]1(C)O[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@H](COS(=O)(=O)c2ccc(C)cc2)O[C@@]1(C)OC |
| InChI | InChI=1S/C24H32O10S2/c1-17-7-11-19(12-8-17)35(25,26)31-15-21-22(34-24(4,30-6)23(3,29-5)33-21)16-32-36(27,28)20-13-9-18(2)10-14-20/h7-14,21-22H,15-16H2,1-6H3/t21-,22-,23+,24+/m0/s1 |
| InChIKey | CIZLVXBAALAMNQ-CJRSTVEYSA-N |
| XLogP | 2.92 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|