C29H40O6SSi — CID 10768914
(4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoic acid (PubChem CID 10768914) has the molecular formula C29H40O6SSi and a molecular weight of 544.79 g/mol. Its IUPAC name is (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoic acid.
| Compound Name | (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoic acid |
|---|---|
| PubChem CID | 10768914 |
| Molecular Formula | C29H40O6SSi |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | (4S,7Z,11R,12Z)-11-[tert-butyl(dimethyl)silyl]oxy-14-hydroxy-4-(methoxymethoxy)-11-methyl-12-phenylsulfanyltetradeca-7,12-dien-5,9-diynoic acid |
| SMILES | COCO[C@H](C#C/C=C\C#C[C@@](C)(O[Si](C)(C)C(C)(C)C)/C(=C/CO)Sc1ccccc1)CCC(=O)O |
| InChI | InChI=1S/C29H40O6SSi/c1-28(2,3)37(6,7)35-29(4,26(20-22-30)36-25-16-12-10-13-17-25)21-14-9-8-11-15-24(34-23-33-5)18-19-27(31)32/h8-10,12-13,16-17,20,24,30H,18-19,22-23H2,1-7H3,(H,31,32)/b9-8-,26-20-/t24-,29-/m1/s1 |
| InChIKey | SNPQHEVRZQDGHU-OCAGZWGHSA-N |
| XLogP | 5.85 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|