C15H23NO3 — CID 107689251
N-butan-2-yl-N-butyl-2,6-dihydroxybenzamide (PubChem CID 107689251) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is N-butan-2-yl-N-butyl-2,6-dihydroxybenzamide.
| Compound Name | N-butan-2-yl-N-butyl-2,6-dihydroxybenzamide |
|---|---|
| PubChem CID | 107689251 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N-butan-2-yl-N-butyl-2,6-dihydroxybenzamide |
| SMILES | CCCCN(C(=O)c1c(O)cccc1O)C(C)CC |
| InChI | InChI=1S/C15H23NO3/c1-4-6-10-16(11(3)5-2)15(19)14-12(17)8-7-9-13(14)18/h7-9,11,17-18H,4-6,10H2,1-3H3 |
| InChIKey | INPIJRFYJADEEW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |