C15H13ClFNO3 — CID 107690723
N-(3-chlorophenyl)-2-[2-fluoro-4-(hydroxymethyl)phenoxy]acetamide (PubChem CID 107690723) has the molecular formula C15H13ClFNO3 and a molecular weight of 309.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2-fluoro-4-(hydroxymethyl)phenoxy]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2-fluoro-4-(hydroxymethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 107690723 |
| Molecular Formula | C15H13ClFNO3 |
| Molecular Weight | 309.72 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2-fluoro-4-(hydroxymethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(CO)cc1F)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClFNO3/c16-11-2-1-3-12(7-11)18-15(20)9-21-14-5-4-10(8-19)6-13(14)17/h1-7,19H,8-9H2,(H,18,20) |
| InChIKey | BCRLIRHUTWMMLW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.72 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |