C33H49N3O5 — CID 10769339
tert-butyl N-[(2S)-1-[[1-(9-hydroxynonylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 10769339) has the molecular formula C33H49N3O5 and a molecular weight of 567.77 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[1-(9-hydroxynonylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[1-(9-hydroxynonylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10769339 |
| Molecular Formula | C33H49N3O5 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.37 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[1-(9-hydroxynonylamino)-2-methyl-1-oxo-3-phenylpropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)NC(C)(Cc1ccccc1)C(=O)NCCCCCCCCCO |
| InChI | InChI=1S/C33H49N3O5/c1-32(2,3)41-31(40)35-28(24-26-18-12-10-13-19-26)29(38)36-33(4,25-27-20-14-11-15-21-27)30(39)34-22-16-8-6-5-7-9-17-23-37/h10-15,18-21,28,37H,5-9,16-17,22-25H2,1-4H3,(H,34,39)(H,35,40)(H,36,38)/t28-,33?/m0/s1 |
| InChIKey | LWDXMVWKNRMCQS-YCIOTGQKSA-N |
| XLogP | 5.08 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|