About 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol
4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol (PubChem CID 107693894) has the molecular formula C10H12FNO3
and a molecular weight of 213.21 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol.
Molecular Properties
| Compound Name | 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol |
| PubChem CID | 107693894 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol |
| SMILES | NCC1COC(c2ccc(O)c(F)c2)O1 |
| InChI | InChI=1S/C10H12FNO3/c11-8-3-6(1-2-9(8)13)10-14-5-7(4-12)15-10/h1-3,7,10,13H,4-5,12H2 |
| InChIKey | NEUDHPXNLIAWGN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol?
The IUPAC name of 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol (CID 107693894) is 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol.
What is the SMILES notation for 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol?
The canonical SMILES for 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol is NCC1COC(c2ccc(O)c(F)c2)O1.
What is the InChIKey of 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol?
The InChIKey is NEUDHPXNLIAWGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO3/c11-8-3-6(1-2-9(8)13)10-14-5-7(4-12)15-10/h1-3,7,10,13H,4-5,12H2.
What are the key properties of 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol?
4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol has a molecular weight of 213.21 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(aminomethyl)-1,3-dioxolan-2-yl]-2-fluorophenol is sourced from PubChem (CID 107693894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).