C34H37NO7 — CID 10769410
[(2S,3aS,4R,6R)-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2-(2-phenylmethoxyacetyl)-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate (PubChem CID 10769410) has the molecular formula C34H37NO7 and a molecular weight of 571.67 g/mol. Its IUPAC name is [(2S,3aS,4R,6R)-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2-(2-phenylmethoxyacetyl)-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate.
| Compound Name | [(2S,3aS,4R,6R)-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2-(2-phenylmethoxyacetyl)-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
|---|---|
| PubChem CID | 10769410 |
| Molecular Formula | C34H37NO7 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | [(2S,3aS,4R,6R)-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2-(2-phenylmethoxyacetyl)-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
| SMILES | O=C(O[C@@H]1C[C@H](O[C@H]2CCCC[C@@H]2c2ccccc2)ON2O[C@H](C(=O)COCc3ccccc3)C[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C34H37NO7/c36-29(23-38-22-24-12-4-1-5-13-24)32-20-28-31(40-34(37)26-16-8-3-9-17-26)21-33(42-35(28)41-32)39-30-19-11-10-18-27(30)25-14-6-2-7-15-25/h1-9,12-17,27-28,30-33H,10-11,18-23H2/t27-,28+,30+,31-,32+,33-/m1/s1 |
| InChIKey | SOJNIKLDSSZJLT-JIIFBTGUSA-N |
| XLogP | 5.78 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |