C15H13BrFNO2 — CID 107694178
4-(4-amino-7-bromo-3,4-dihydro-2H-chromen-2-yl)-2-fluorophenol (PubChem CID 107694178) has the molecular formula C15H13BrFNO2 and a molecular weight of 338.18 g/mol. Its IUPAC name is 4-(4-amino-7-bromo-3,4-dihydro-2H-chromen-2-yl)-2-fluorophenol.
| Compound Name | 4-(4-amino-7-bromo-3,4-dihydro-2H-chromen-2-yl)-2-fluorophenol |
|---|---|
| PubChem CID | 107694178 |
| Molecular Formula | C15H13BrFNO2 |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 4-(4-amino-7-bromo-3,4-dihydro-2H-chromen-2-yl)-2-fluorophenol |
| SMILES | NC1CC(c2ccc(O)c(F)c2)Oc2cc(Br)ccc21 |
| InChI | InChI=1S/C15H13BrFNO2/c16-9-2-3-10-12(18)7-14(20-15(10)6-9)8-1-4-13(19)11(17)5-8/h1-6,12,14,19H,7,18H2 |
| InChIKey | RSLJUVGVBAOEOS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |