C11H16FNO3 — CID 107695240
3-[4-fluoro-2-(methylaminomethyl)phenoxy]propane-1,2-diol (PubChem CID 107695240) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-[4-fluoro-2-(methylaminomethyl)phenoxy]propane-1,2-diol.
| Compound Name | 3-[4-fluoro-2-(methylaminomethyl)phenoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 107695240 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-[4-fluoro-2-(methylaminomethyl)phenoxy]propane-1,2-diol |
| SMILES | CNCc1cc(F)ccc1OCC(O)CO |
| InChI | InChI=1S/C11H16FNO3/c1-13-5-8-4-9(12)2-3-11(8)16-7-10(15)6-14/h2-4,10,13-15H,5-7H2,1H3 |
| InChIKey | SJCHQGGJXILRIH-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |