C35H37N5O4 — CID 10769748
N-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetamide (PubChem CID 10769748) has the molecular formula C35H37N5O4 and a molecular weight of 591.71 g/mol. Its IUPAC name is N-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 10769748 |
| Molecular Formula | C35H37N5O4 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | N-[3-[[1-(1-adamantylmethyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]carbamoylamino]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)NC2C(=O)N(CC34CC5CC(CC(C5)C3)C4)c3ccccc3N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C35H37N5O4/c1-22(41)36-26-8-7-9-27(17-26)37-34(44)38-31-32(42)39(21-35-18-23-14-24(19-35)16-25(15-23)20-35)29-12-5-6-13-30(29)40(33(31)43)28-10-3-2-4-11-28/h2-13,17,23-25,31H,14-16,18-21H2,1H3,(H,36,41)(H2,37,38,44) |
| InChIKey | JATZNFJNGLRAJC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|