C14H9F3O2 — CID 107697829
2-[(2,3-difluorophenyl)methoxy]-5-fluorobenzaldehyde (PubChem CID 107697829) has the molecular formula C14H9F3O2 and a molecular weight of 266.22 g/mol. Its IUPAC name is 2-[(2,3-difluorophenyl)methoxy]-5-fluorobenzaldehyde.
| Compound Name | 2-[(2,3-difluorophenyl)methoxy]-5-fluorobenzaldehyde |
|---|---|
| PubChem CID | 107697829 |
| Molecular Formula | C14H9F3O2 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2-[(2,3-difluorophenyl)methoxy]-5-fluorobenzaldehyde |
| SMILES | O=Cc1cc(F)ccc1OCc1cccc(F)c1F |
| InChI | InChI=1S/C14H9F3O2/c15-11-4-5-13(10(6-11)7-18)19-8-9-2-1-3-12(16)14(9)17/h1-7H,8H2 |
| InChIKey | WMMOLNNXMRROAO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|