C12H10Br2N2O3S — CID 107697937
N-(2-amino-4-hydroxyphenyl)-2,5-dibromobenzenesulfonamide (PubChem CID 107697937) has the molecular formula C12H10Br2N2O3S and a molecular weight of 422.10 g/mol. Its IUPAC name is N-(2-amino-4-hydroxyphenyl)-2,5-dibromobenzenesulfonamide.
| Compound Name | N-(2-amino-4-hydroxyphenyl)-2,5-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 107697937 |
| Molecular Formula | C12H10Br2N2O3S |
| Molecular Weight | 422.10 g/mol |
| Exact Mass | 419.88 |
| IUPAC Name | N-(2-amino-4-hydroxyphenyl)-2,5-dibromobenzenesulfonamide |
| SMILES | Nc1cc(O)ccc1NS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H10Br2N2O3S/c13-7-1-3-9(14)12(5-7)20(18,19)16-11-4-2-8(17)6-10(11)15/h1-6,16-17H,15H2 |
| InChIKey | BPDAWPOMPGELHU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|