C15H14FNO3 — CID 107698154
2-(5-fluoro-2-hydroxyphenyl)-2-(2-methylanilino)acetic acid (PubChem CID 107698154) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-(5-fluoro-2-hydroxyphenyl)-2-(2-methylanilino)acetic acid.
| Compound Name | 2-(5-fluoro-2-hydroxyphenyl)-2-(2-methylanilino)acetic acid |
|---|---|
| PubChem CID | 107698154 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 2-(5-fluoro-2-hydroxyphenyl)-2-(2-methylanilino)acetic acid |
| SMILES | Cc1ccccc1NC(C(=O)O)c1cc(F)ccc1O |
| InChI | InChI=1S/C15H14FNO3/c1-9-4-2-3-5-12(9)17-14(15(19)20)11-8-10(16)6-7-13(11)18/h2-8,14,17-18H,1H3,(H,19,20) |
| InChIKey | VKQBQMKFTGCZEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|