C16H16BrFO — CID 107698949
2-(bromomethyl)-1-[(2,5-dimethylphenyl)methoxy]-4-fluorobenzene (PubChem CID 107698949) has the molecular formula C16H16BrFO and a molecular weight of 323.21 g/mol. Its IUPAC name is 2-(bromomethyl)-1-[(2,5-dimethylphenyl)methoxy]-4-fluorobenzene.
| Compound Name | 2-(bromomethyl)-1-[(2,5-dimethylphenyl)methoxy]-4-fluorobenzene |
|---|---|
| PubChem CID | 107698949 |
| Molecular Formula | C16H16BrFO |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 2-(bromomethyl)-1-[(2,5-dimethylphenyl)methoxy]-4-fluorobenzene |
| SMILES | Cc1ccc(C)c(COc2ccc(F)cc2CBr)c1 |
| InChI | InChI=1S/C16H16BrFO/c1-11-3-4-12(2)14(7-11)10-19-16-6-5-15(18)8-13(16)9-17/h3-8H,9-10H2,1-2H3 |
| InChIKey | GADQRHFDKXVDHS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|