C36H46N2O4S — CID 10769927
10-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyldecanenitrile (PubChem CID 10769927) has the molecular formula C36H46N2O4S and a molecular weight of 602.84 g/mol. Its IUPAC name is 10-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyldecanenitrile.
| Compound Name | 10-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyldecanenitrile |
|---|---|
| PubChem CID | 10769927 |
| Molecular Formula | C36H46N2O4S |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.32 |
| IUPAC Name | 10-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyldecanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCCCCN2CCc3cc(OC)c(OC)cc3C2)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C36H46N2O4S/c1-27-12-15-31(16-13-27)43-36(26-37,30-14-17-32(39-2)35(24-30)42-5)19-10-8-6-7-9-11-20-38-21-18-28-22-33(40-3)34(41-4)23-29(28)25-38/h12-17,22-24H,6-11,18-21,25H2,1-5H3 |
| InChIKey | IHQOGGCMRWUGRD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|