C32H44N8O4 — CID 10769955
1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene-10,25,28,37-tetrone (PubChem CID 10769955) has the molecular formula C32H44N8O4 and a molecular weight of 604.76 g/mol. Its IUPAC name is 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene-10,25,28,37-tetrone.
| Compound Name | 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene-10,25,28,37-tetrone |
|---|---|
| PubChem CID | 10769955 |
| Molecular Formula | C32H44N8O4 |
| Molecular Weight | 604.76 g/mol |
| Exact Mass | 604.35 |
| IUPAC Name | 1,8,11,14,21,24,29,36-octazapentacyclo[19.5.5.58,14.23,6.216,19]tetraconta-3(40),4,6(39),16,18,32-hexaene-10,25,28,37-tetrone |
| SMILES | O=C1CN2CC(=O)NCCN(CCN1)Cc1ccc(cc1)CN1CCNC(=O)CN(CC(=O)NCC1)Cc1ccc(cc1)C2 |
| InChI | InChI=1S/C32H44N8O4/c41-29-21-39-19-27-5-7-28(8-6-27)20-40-23-31(43)35-11-15-38(16-12-36-32(44)24-40)18-26-2-1-25(3-4-26)17-37(13-9-33-29)14-10-34-30(42)22-39/h1-8H,9-24H2,(H,33,41)(H,34,42)(H,35,43)(H,36,44) |
| InChIKey | NPGBDERQMQKXAK-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.76 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |