C12H16N2O4 — CID 107702086
[2-(aminomethyl)morpholin-4-yl]-(3,5-dihydroxyphenyl)methanone (PubChem CID 107702086) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is [2-(aminomethyl)morpholin-4-yl]-(3,5-dihydroxyphenyl)methanone.
| Compound Name | [2-(aminomethyl)morpholin-4-yl]-(3,5-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107702086 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | [2-(aminomethyl)morpholin-4-yl]-(3,5-dihydroxyphenyl)methanone |
| SMILES | NCC1CN(C(=O)c2cc(O)cc(O)c2)CCO1 |
| InChI | InChI=1S/C12H16N2O4/c13-6-11-7-14(1-2-18-11)12(17)8-3-9(15)5-10(16)4-8/h3-5,11,15-16H,1-2,6-7,13H2 |
| InChIKey | PMOXGYRVENNLAD-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |