C35H49NO7Si — CID 10770215
[(2S,3aS,4R,6R)-2-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyacetyl]-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate (PubChem CID 10770215) has the molecular formula C35H49NO7Si and a molecular weight of 623.86 g/mol. Its IUPAC name is [(2S,3aS,4R,6R)-2-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyacetyl]-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate.
| Compound Name | [(2S,3aS,4R,6R)-2-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyacetyl]-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
|---|---|
| PubChem CID | 10770215 |
| Molecular Formula | C35H49NO7Si |
| Molecular Weight | 623.86 g/mol |
| Exact Mass | 623.33 |
| IUPAC Name | [(2S,3aS,4R,6R)-2-[2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxyacetyl]-6-[(1S,2R)-2-phenylcyclohexyl]oxy-2,3,3a,4,5,6-hexahydro-[1,2]oxazolo[2,3-b]oxazin-4-yl] benzoate |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OCC(=O)[C@@H]1C[C@H]2[C@H](OC(=O)c3ccccc3)C[C@H](O[C@H]3CCCC[C@@H]3c3ccccc3)ON2O1 |
| InChI | InChI=1S/C35H49NO7Si/c1-24(2)35(3,4)44(5,6)39-23-29(37)32-21-28-31(41-34(38)26-17-11-8-12-18-26)22-33(43-36(28)42-32)40-30-20-14-13-19-27(30)25-15-9-7-10-16-25/h7-12,15-18,24,27-28,30-33H,13-14,19-23H2,1-6H3/t27-,28+,30+,31-,32+,33-/m1/s1 |
| InChIKey | NJLYMGBZVUPNLM-JIIFBTGUSA-N |
| XLogP | 7.22 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.86 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|