C31H48O11Si — CID 10770227
tetramethyl (E)-9-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]-3-methylidenenon-7-ene-1,1,5,5-tetracarboxylate (PubChem CID 10770227) has the molecular formula C31H48O11Si and a molecular weight of 624.80 g/mol. Its IUPAC name is tetramethyl (E)-9-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]-3-methylidenenon-7-ene-1,1,5,5-tetracarboxylate.
| Compound Name | tetramethyl (E)-9-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]-3-methylidenenon-7-ene-1,1,5,5-tetracarboxylate |
|---|---|
| PubChem CID | 10770227 |
| Molecular Formula | C31H48O11Si |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | tetramethyl (E)-9-[2-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-methoxycarbonylcyclopropyl]-3-methylidenenon-7-ene-1,1,5,5-tetracarboxylate |
| SMILES | C=CC1(O[Si](C)(C)C(C)(C)C)CC1(C/C=C/CC(CC(=C)CC(C(=O)OC)C(=O)OC)(C(=O)OC)C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C31H48O11Si/c1-13-31(42-43(11,12)28(3,4)5)20-30(31,27(36)41-10)17-15-14-16-29(25(34)39-8,26(35)40-9)19-21(2)18-22(23(32)37-6)24(33)38-7/h13-15,22H,1-2,16-20H2,3-12H3/b15-14+ |
| InChIKey | CVUFDYJPQWNBCM-CCEZHUSRSA-N |
| XLogP | 4.46 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|