C39H35N3O5 — CID 10770234
methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 10770234) has the molecular formula C39H35N3O5 and a molecular weight of 625.73 g/mol. Its IUPAC name is methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10770234 |
| Molecular Formula | C39H35N3O5 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | methyl (1R,3S)-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccccc2)N1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C39H35N3O5/c1-46-38(44)34-22-30-29-18-9-10-19-32(29)40-35(30)36(24-12-3-2-4-13-24)42(34)37(43)33-20-11-21-41(33)39(45)47-23-31-27-16-7-5-14-25(27)26-15-6-8-17-28(26)31/h2-10,12-19,31,33-34,36,40H,11,20-23H2,1H3/t33-,34-,36+/m0/s1 |
| InChIKey | MDCZVYAYROAOJR-IXQHYERASA-N |
| XLogP | 6.60 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|