2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid

C14H10FNO5 — CID 107702397

IUPAC2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid
SMILESO=C(Nc1cccc(F)c1C(=O)O)c1cc(O)cc(O)c1
InChIInChI=1S/C14H10FNO5/c15-10-2-1-3-11(12(10)14(20)21)16-13(19)7-4-8(17)6-9(18)5-7/h1-6,17-18H,(H,16,19)(H,20,21)
InChIKeyXGHAYZDKABUTMF-UHFFFAOYSA-N
MW291.23 g/mol
LogP2.19
Rot. Bonds3

About 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid

2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid (PubChem CID 107702397) has the molecular formula C14H10FNO5 and a molecular weight of 291.23 g/mol. Its IUPAC name is 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid.

Molecular Properties

Compound Name2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid
PubChem CID107702397
Molecular FormulaC14H10FNO5
Molecular Weight291.23 g/mol
Exact Mass291.05
IUPAC Name2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid
SMILESO=C(Nc1cccc(F)c1C(=O)O)c1cc(O)cc(O)c1
InChIInChI=1S/C14H10FNO5/c15-10-2-1-3-11(12(10)14(20)21)16-13(19)7-4-8(17)6-9(18)5-7/h1-6,17-18H,(H,16,19)(H,20,21)
InChIKeyXGHAYZDKABUTMF-UHFFFAOYSA-N
XLogP2.19
TPSA106.86 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.23
LogP ≤ 52.19
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid?
The IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid (CID 107702397) is 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid.
What is the SMILES notation for 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid?
The canonical SMILES for 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid is O=C(Nc1cccc(F)c1C(=O)O)c1cc(O)cc(O)c1.
What is the InChIKey of 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid?
The InChIKey is XGHAYZDKABUTMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FNO5/c15-10-2-1-3-11(12(10)14(20)21)16-13(19)7-4-8(17)6-9(18)5-7/h1-6,17-18H,(H,16,19)(H,20,21).
What are the key properties of 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid?
2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid has a molecular weight of 291.23 g/mol, XLogP of 2.19, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dihydroxybenzoyl)amino]-6-fluorobenzoic acid is sourced from PubChem (CID 107702397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).