C27H45N3O8SSi2 — CID 10770258
N-[[(5R,6R,8S,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]carbamoyl]benzamide (PubChem CID 10770258) has the molecular formula C27H45N3O8SSi2 and a molecular weight of 627.91 g/mol. Its IUPAC name is N-[[(5R,6R,8S,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]carbamoyl]benzamide.
| Compound Name | N-[[(5R,6R,8S,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 10770258 |
| Molecular Formula | C27H45N3O8SSi2 |
| Molecular Weight | 627.91 g/mol |
| Exact Mass | 627.25 |
| IUPAC Name | N-[[(5R,6R,8S,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-1,7-dioxa-2λ6-thiaspiro[4.4]non-3-en-8-yl]carbamoyl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](NC(=O)NC(=O)c2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@]12OS(=O)(=O)C=C2N |
| InChI | InChI=1S/C27H45N3O8SSi2/c1-25(2,3)40(7,8)35-16-20-27(19(28)17-39(33,34)38-27)21(37-41(9,10)26(4,5)6)23(36-20)30-24(32)29-22(31)18-14-12-11-13-15-18/h11-15,17,20-21,23H,16,28H2,1-10H3,(H2,29,30,31,32)/t20-,21+,23+,27-/m1/s1 |
| InChIKey | AYIUTSVQZSFZHT-XRVDZLCPSA-N |
| XLogP | 4.16 |
| TPSA | 155.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|