About 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid
2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid (PubChem CID 107702822) has the molecular formula C14H17NO5
and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid |
| PubChem CID | 107702822 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCCC1NC(=O)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C14H17NO5/c1-14(13(19)20)4-2-3-11(14)15-12(18)8-5-9(16)7-10(17)6-8/h5-7,11,16-17H,2-4H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | TWJDEDKTQFLVJM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid?
The IUPAC name of 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid (CID 107702822) is 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid.
What is the SMILES notation for 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid?
The canonical SMILES for 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid is CC1(C(=O)O)CCCC1NC(=O)c1cc(O)cc(O)c1.
What is the InChIKey of 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid?
The InChIKey is TWJDEDKTQFLVJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO5/c1-14(13(19)20)4-2-3-11(14)15-12(18)8-5-9(16)7-10(17)6-8/h5-7,11,16-17H,2-4H2,1H3,(H,15,18)(H,19,20).
What are the key properties of 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid?
2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid has a molecular weight of 279.29 g/mol, XLogP of 1.47, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dihydroxybenzoyl)amino]-1-methylcyclopentane-1-carboxylic acid is sourced from PubChem (CID 107702822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).