C12H22N4OS — CID 107703973
6-[[5-(aminomethyl)-4-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol (PubChem CID 107703973) has the molecular formula C12H22N4OS and a molecular weight of 270.40 g/mol. Its IUPAC name is 6-[[5-(aminomethyl)-4-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol.
| Compound Name | 6-[[5-(aminomethyl)-4-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol |
|---|---|
| PubChem CID | 107703973 |
| Molecular Formula | C12H22N4OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 6-[[5-(aminomethyl)-4-cyclopropyl-1,2,4-triazol-3-yl]sulfanyl]hexan-1-ol |
| SMILES | NCc1nnc(SCCCCCCO)n1C1CC1 |
| InChI | InChI=1S/C12H22N4OS/c13-9-11-14-15-12(16(11)10-5-6-10)18-8-4-2-1-3-7-17/h10,17H,1-9,13H2 |
| InChIKey | BVSXDCKWQUXKOK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|