C33H49N5O8 — CID 10770448
tert-butyl 2-[(3R,6R,9S,12R,15S)-6-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate (PubChem CID 10770448) has the molecular formula C33H49N5O8 and a molecular weight of 643.78 g/mol. Its IUPAC name is tert-butyl 2-[(3R,6R,9S,12R,15S)-6-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,6R,9S,12R,15S)-6-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate |
|---|---|
| PubChem CID | 10770448 |
| Molecular Formula | C33H49N5O8 |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | tert-butyl 2-[(3R,6R,9S,12R,15S)-6-[(4-hydroxyphenyl)methyl]-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-12-propan-2-yl-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)OC(C)(C)C)NC(=O)[C@@H](Cc2ccc(O)cc2)NC1=O |
| InChI | InChI=1S/C33H49N5O8/c1-18(2)15-22-28(41)34-23(16-20-10-12-21(39)13-11-20)29(42)36-24(17-26(40)46-33(5,6)7)32(45)38-14-8-9-25(38)30(43)37-27(19(3)4)31(44)35-22/h10-13,18-19,22-25,27,39H,8-9,14-17H2,1-7H3,(H,34,41)(H,35,44)(H,36,42)(H,37,43)/t22-,23+,24+,25-,27+/m0/s1 |
| InChIKey | NWMYLVQWDKQJFK-PETBULSVSA-N |
| XLogP | 1.31 |
| TPSA | 183.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |