C12H10N4O2 — CID 107704580
5-(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,3-diol (PubChem CID 107704580) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 5-(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,3-diol.
| Compound Name | 5-(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107704580 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 5-(5-amino-1H-imidazo[4,5-b]pyridin-2-yl)benzene-1,3-diol |
| SMILES | Nc1ccc2[nH]c(-c3cc(O)cc(O)c3)nc2n1 |
| InChI | InChI=1S/C12H10N4O2/c13-10-2-1-9-12(15-10)16-11(14-9)6-3-7(17)5-8(18)4-6/h1-5,17-18H,(H3,13,14,15,16) |
| InChIKey | IWSWSJVQCZZGPY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |