C12H26N2O — CID 107704779
6-(4-methyl-1,4-diazepan-1-yl)hexan-1-ol (PubChem CID 107704779) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 6-(4-methyl-1,4-diazepan-1-yl)hexan-1-ol.
| Compound Name | 6-(4-methyl-1,4-diazepan-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 107704779 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 6-(4-methyl-1,4-diazepan-1-yl)hexan-1-ol |
| SMILES | CN1CCCN(CCCCCCO)CC1 |
| InChI | InChI=1S/C12H26N2O/c1-13-7-6-9-14(11-10-13)8-4-2-3-5-12-15/h15H,2-12H2,1H3 |
| InChIKey | SLRJDFMPOMAYCW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|