C16H17Cl2NO2 — CID 107704995
5-[1-[2-(2,4-dichlorophenyl)ethylamino]ethyl]benzene-1,3-diol (PubChem CID 107704995) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 5-[1-[2-(2,4-dichlorophenyl)ethylamino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[2-(2,4-dichlorophenyl)ethylamino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107704995 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 5-[1-[2-(2,4-dichlorophenyl)ethylamino]ethyl]benzene-1,3-diol |
| SMILES | CC(NCCc1ccc(Cl)cc1Cl)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C16H17Cl2NO2/c1-10(12-6-14(20)9-15(21)7-12)19-5-4-11-2-3-13(17)8-16(11)18/h2-3,6-10,19-21H,4-5H2,1H3 |
| InChIKey | ULRJMGBJGDYEGP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |