About 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol
5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol (PubChem CID 107705503) has the molecular formula C13H19NO4S
and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol |
| PubChem CID | 107705503 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol |
| SMILES | CC(NC1(C)CCS(=O)(=O)C1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-9(10-5-11(15)7-12(16)6-10)14-13(2)3-4-19(17,18)8-13/h5-7,9,14-16H,3-4,8H2,1-2H3 |
| InChIKey | OQIWTNLJVCQWMS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol?
The IUPAC name of 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol (CID 107705503) is 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol.
What is the SMILES notation for 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol?
The canonical SMILES for 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol is CC(NC1(C)CCS(=O)(=O)C1)c1cc(O)cc(O)c1.
What is the InChIKey of 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol?
The InChIKey is OQIWTNLJVCQWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4S/c1-9(10-5-11(15)7-12(16)6-10)14-13(2)3-4-19(17,18)8-13/h5-7,9,14-16H,3-4,8H2,1-2H3.
What are the key properties of 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol?
5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol has a molecular weight of 285.37 g/mol, XLogP of 1.33, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-[(3-methyl-1,1-dioxothiolan-3-yl)amino]ethyl]benzene-1,3-diol is sourced from PubChem (CID 107705503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).